The structure of 4-Methylpent-2-en-1-ol is: (a) CH3CH2CH=CHCH2OH(b)(CH3)2C=CHCH2CH2OH (c)(CH3)2CHCH=CHCH2OH(d)CH3CH(OH)CH-CH=C(CH3)2.

The structure of 4-Methylpent-2-en-1-ol is: (d) CH3CH(OH)CH-CH=C(CH3)2.

Here's the step-by-step explanation:

1. The name 4-Methylpent-2-en-1-ol tells us about the structure of the molecule.

2. "Pent" indicates that there are five carbon atoms in the longest carbon chain.

3. The "2-en" part tells us that there is a double bond starting from the second carbon atom.

4. "4-Methyl" indicates that there is a methyl group (CH3) attached to the fourth carbon atom.

5. The "1-ol" part tells us that there is a hydroxyl group (-OH) attached to the first carbon atom.

6. Putting all this information together, we get the structure: CH3CH(OH)CH-CH=C(CH3)2.

So, the correct answer is (d) CH3CH(OH)CH-CH=C(CH3)2.