Which compound is a secondary amine?Group of answer choices(CH3)2NCH2CH3NH2CH2CH3CH3CH2NHCH(CH3)CH2CH3CH3CH(NH2)CH3
Question
Which compound is a secondary amine?
Group of answer choices:
(CH3)2NCH2CH3NH2CH2CH3CH3CH2NHCH(CH3)CH2CH3CH3CH(NH2)CH3
Solution
A secondary amine is a compound where the nitrogen atom is connected to two alkyl or aryl groups and one hydrogen atom.
Looking at the given options:
-
(CH3)2NCH2CH3: This is a tertiary amine because the nitrogen atom is connected to three alkyl groups.
-
NH2CH2CH3: This is a primary amine because the nitrogen atom is connected to one alkyl group and two hydrogen atoms.
-
CH3CH2NHCH(CH3)CH2CH3: This is a secondary amine because the nitrogen atom is connected to two alkyl groups and one hydrogen atom.
-
CH3CH(NH2)CH3: This is a primary amine because the nitrogen atom is connected to one alkyl group and two hydrogen atoms.
So, the compound CH3CH2NHCH(CH3)CH2CH3 is a secondary amine.
Similar Questions
CH3-CH2-NH-CH3 is a __________Group of answer choicessecondary amineprimary aminequaternary aminetertiary amine
Which of the following is a secondary amine ?A Aniline B Toluidine C Hexamethylene diamine D Ethylmethyl amine
CH3-CH2-NH-CH3Name the compound aboveGroup of answer choicesEthylaminemethylamineEthylmethylaminepropylamine
Amines function chemically as organic ____.Group of answer choicesacidsbasessaltsmore than one response is correct
Identify the IUPAC name for CH3NH2.Select answer from the options belowethylaminemethanamineethanaminepropanaminepropylaminemethylamine
Upgrade your grade with Knowee
Get personalized homework help. Review tough concepts in more detail, or go deeper into your topic by exploring other relevant questions.