Identify the IUPAC name for CH3NH2.Select answer from the options belowethylaminemethanamineethanaminepropanaminepropylaminemethylamine
Question
Identify the IUPAC name for CH3NH2.
Select answer from the options below:
- ethylamine
- methanamine
- ethanamine
- propanamine
- propylamine
- methylamine
Solution
Break Down the Problem
- Identify the molecular formula given: CH₃NH₂.
- Analyze the structure of the molecule to determine the longest carbon chain and functional groups.
Relevant Concepts
- The IUPAC naming rules state that the longest carbon chain is identified first, and then the functional groups are used to form the name.
- NH₂ (amino group) makes the compound an amine.
- A carbon atom with three hydrogens (CH₃) indicates a methyl group.
Analysis and Detail
- The molecule has a single carbon (C) atom which is bonded to three hydrogen (H) atoms (this represents a methyl group, CH₃).
- The nitrogen (N) is attached to this carbon atom and has two hydrogen atoms attached (NH₂), making it an amine since it contains the amino group.
- The longest carbon chain contains only one carbon, and with the amino group, the correct name follows the amine nomenclature.
Verify and Summarize
- The longest carbon chain has 1 carbon atom.
- The amino group attached results in the name being based on the parent structure, which is methane (1 carbon).
- Adding the amine suffix to the parent name, we get methanamine.
Final Answer
The IUPAC name for CH₃NH₂ is methanamine.
Similar Questions
CH3-CH2-NH-CH3Name the compound aboveGroup of answer choicesEthylaminemethylamineEthylmethylaminepropylamine
CH3-CH2-NH-CH3 is a __________Group of answer choicessecondary amineprimary aminequaternary aminetertiary amine
Which compound is a secondary amine?Group of answer choices(CH3)2NCH2CH3NH2CH2CH3CH3CH2NHCH(CH3)CH2CH3CH3CH(NH2)CH3
Write the IUPAC name of the given compound. A 3-ethyl-2 methyl pentane B 3-ethyl-4 methyl pentane C 2-methyl-3 ethyl pentane D 3,3-diethyl pentane
What is the structure of N-ethyl-N-methyl Ethanamine ?A CH3NHCH(CH3)2 B (CH3)2NCH2CH3 C (CH3CH2)2NCH3 D (CH3)3CNH2
Upgrade your grade with Knowee
Get personalized homework help. Review tough concepts in more detail, or go deeper into your topic by exploring other relevant questions.