Knowee
Questions
Features
Study Tools

Which functional group is characteristic of carboxylic acids?a. -OHb. -CHOc. -COOHd. -NH2

Question

Which functional group is characteristic of carboxylic acids?

a. -OH
b. -CHO
c. -COOH
d. -NH2

🧐 Not the exact question you are looking for?Go ask a question

Solution

Break Down the Problem

  1. Identify the functional groups listed in the options.
  2. Determine which functional group is specifically associated with carboxylic acids.

Relevant Concepts

  • Functional groups are specific groups of atoms within molecules that are responsible for the characteristic chemical reactions of those molecules.
  • Carboxylic acids are organic compounds that contain a carboxyl group (-COOH).

Analysis and Detail

  1. -OH: This is the hydroxyl group, characteristic of alcohols.
  2. -CHO: This is the aldehyde group, found in aldehydes.
  3. -COOH: This is the carboxyl group, which defines carboxylic acids.
  4. -NH2: This is the amino group, often found in amines and amino acids.

Among the provided options, the carboxyl group (-COOH) is the correct one associated with carboxylic acids.

Verify and Summarize

After analyzing all the given options and their characteristics, it is clear that the carboxylic acids are defined by the presence of the carboxyl functional group.

Final Answer

The functional group characteristic of carboxylic acids is c. -COOH.

This problem has been solved

Similar Questions

Which functional group does formic acid contain?A.COOB.OC.COOHD.OHSUBMITarrow_backPREVIOUS

Which of the following is classified as a carboxylic acid?Select answer from the options below(CH3)3CCO2CH3(CH3)3CCO2HCO2CH3CO2CH2CH3

Which of the following functional groups is matched with its correct name?ANSWERR-NH2: methyl groupR-OH: hydroxyl groupR-CH3: ester groupR-COOH: ether group

Which of the following functional groups is NOT found on the protonated G-acid?A)     AlcoholB)     BenzeneC)     SulfonateD)     Sulfite

Which functional group has the general formula NH2?A.AmineB.ThiolC.EsterD.Alcohol

1/3

Upgrade your grade with Knowee

Get personalized homework help. Review tough concepts in more detail, or go deeper into your topic by exploring other relevant questions.