Knowee
Questions
Features
Study Tools
Your ai homework helper
Drag Image or Click Here to Upload.

The Homework Questions and Answers

Recent questions
n terms of food capture, which sponge cell is most similar to the cnidocyte of acnidarian?a) amoebocyteb) choanocytec) epidermal celld) pore ce
What do you understand by Organization? Briefly explain the differenttypes of Organizational Structure.
In a Students table with columns StudentID, FirstName, LastName, and Email, which combination of columns can be considered a super key?
The outcomes of point mutations include____.silent mutationall options are correctnonsense mutationmissense mutation
Assertion: Earth has an atmosphere around it but the moon does not.Reason: Moon is very small as compared to the earth
Making this substitution using16 sin2(x) cos3(x) dxgives us 16 sin2(x) (1 − sin2(x)) cos(x) dx = 16 sin2(x) cos(x) dx −  cos(x)  dx.
The electrons of the same orbitals can be distinguished by(a) Principal quantum number(b) Azimuthal quantum number(c) Spin quantum number(d) Magnetic quantum
Write a program in java to accept a number and chech whether it is a palindrome number or not. Do the program without using modulus operator and String.
The solution set of the system of equations log2x + log2y = log29 + 1,    is (p, q) then
A trader gives successive discounts of 10%, 20% and 10% respectively. The percentage of the original cost price he will recover is:
Choose the pair of numbers that is not a solution to the given equation.y = 5 - 2x(0, 3)(2, 1)(1, 3)
9.In what ways can the manner of presenting information affect the representations formed in memory?
What is the formula weight of mercury (I) chloride?Question 3Select one:a.200.6b.236.0c.271.6d.472.2e.307.1
What will be the Least Common Multiple of the numbers divisible by 3 between 26 and 32?
The Supreme Court's power to issue writs under Article 32 for the enforcement of fundamental rights
A cubical box of wood of side 30 cm weighing 21.6 kg floats on water horizontally. The depth of immersion of box is
ABCD is a parallelogram. Point P divides AB in theratio 2:3 and point Q divides DC in the ratio 4:1.Prove that OC is half of OA.
Which of the following would require retrospective application in accordance with IAS 8 Accounting Policies, Changes in Accounting Estimates and Errors?
b) Obtain the monopolist’s average total cost function, average variable cost function,and marginal cost function
Which method in the requests module allows you to send data to an API?Question 5Answera.requests.post()b.requests.put()c.requests.get()d.requests.delete()
The agile project process is also commonly called: Group of answer choicesTraditionalSmartWaterfallPredictableIterative
What is the velocity of an object accelerating at 5.0m/s 2 after 5.0s having started from rest?
Learning with multiple labels, multiple instances and multivariate loss functions
Which ordered pairs are solutions for y = 3x – 5? Choose all that apply. A) (0, -5) B) (1, -2) C) (5, 20) D) (-2, -11) E) (3, 0)
How (and why) did the US end up being a nation dedicated to a capitalist economy?
D and E are points on the sides AB and AC respectively of a . If AB = 10.8 cm, AD = 6.3 cm, AC = 9.6cm, and EC = 4 cm. Determine whether or not.[2]△ABCDE∥BC
What would the main social challenges be for people who move to rural communities from the city?
(Pathogens evolve and cause emergent diseases)Provide a SPECIFIC example of an emergent disease, including its most probable original source.
Who are some notable historical and contemporary polymaths, and what fields have they excelled in?
Which of the following is the stronger Brønsted base?Select answer from the options below(CH3)3CS-(CH3)2CHS-CH3CH2S-
What is the “First-Pass Effect”, and what types of tablet are intended to avoid it?
A baby weighed 6 pounds 9 ounces at birth. How much did it weigh in grams, correct to the nearest tenths?
Determine which absorbs more carbon per year: photosynthesizers on land or in the ocean?
How do you feel about the way gender roles are portrayed in media and education today compared to when you were growing up?
A ball is thrown vertically upwards with a velocity of 49 m/s and g =9.8 m/s2Calculate the max height it rises up to?112.5 m
How were chinampas made? A section of lake was fenced off and filled with mud.1With concrete.2On dry land.3On canoes.4
In 1931, philosopher Alfred Korzybski stated that 'the map is not the territory'. What is meant by this statement?
Find dfa’s that accept the following languages:(a) L = L (ab∗a∗) ∪ L ((ab)∗ ba).
What will be the inductance required to produce ultrasonicwaves of 2.5 MHz having a capacitance of 0.035µF?A 1 1.16 x 10-7H 11.6 uH 11.6 H 11.6 mWb
If the frequency of light in a photoelectricexperiment is doubled, the stopping potential wil
If real GDP falls from one period to another, we can conclude thatNone of these necessarily occursnominal GDP fell.prices decreased.inflation occurred.
Why is diffusion insufficient to meet the oxygen requirements of multi-cellular organisms like humans?
Which gate is commonly used to implement binary addition in digital circuits?Question 8Answera.AND gateb.OR gatec.XOR gated.NOT gate
In a sample of pure water, which of the following is NOT true?*1 point[H+] = [OH-][H+] = 1 x 10^-7 MpH = 7All of the above are true
You expect to have $ 8 000$8 000 in one year. A bank is offering loans at 3.5 %3.5% interest per year. How much can you borrow​ today?
The major tissue type that acts as "a gatekeeper" because it regulates the movement of materials in and out of certain body regions is
Looping-4Read a integer N and print a character pattern with N rows.For example if N=5, the pattern isABBCCCDDDDE E E E E
Which of these sentence(s) is/are propositions?(I) Accra is the capital of Ghana.(II) Ghana is a West African country.(III) 2 + 3 = 5.(IV) 5 + 7 = 10.
How did Dr. Weiss determine that the SAFER evaluation is effective? What did her experiment entail? What does the data show?
________ is the source of the oxygen gas released by a photosystem.C6H12O6Chlorophyll aCO2H2O
Which of these can be an accidental or Intentional error?Human ErrorsSoftware FailuresHardware FailuresViruses
Which of the following vitamins does not participatein the oxidative decarboxylation of pyruvate toacetyl-CoA?a. Thiamine b. Biotinc. Niacin d. Riboflavin
Let f : R → R be continuous at c ∈ R. Then |f | is continuous at c. Give anexample to show that the reverse is not true
If the Math Olympiad Club consists of 14 students, how many different teams of 6 students can be formed for competitions?
In a school, 20% of the students are girls, and the rest are boys. If there are 750 boys, how many students are in the school in total?
Decibels measure sound(a) intensity(b) frequency(c) loudness level(d) all of the above (8.5)
Which of the following types of diagrams is a researcher most likely to use to display interval data? HistogramFrequency tableBar chartPie chart
What is the resistance of a component that has 13A through it when has 240V applied to it?
The magnetic field  due to a small current element  at a distance  and element carrying current is,
8. What does an increase in temperature have an effect on, that controls the rate of photosynthesis?
English is an important laguage. Talk about listening to English songs helps students to improve their english
What is the Kinetic Energy of a 150 kg object that is moving with a speed of 15 m/s?A 2250JB 33750JC 1125JD 16875J
How does an ethnography study different from participant observation? Explain the different categories of notes that may be generated in an ethnographic study.
What was one of the reasons Christianity had not been more successful in reaching the Arab peoples prior to the rise of Islam?
How many integer solutions are there for x + y + z + w = 15 if x ≥ 3,y > −2, z ≥ 1, w > −3?
Which of the following is described by the equation H2O(l) H2O(s) + heat?A.EvaporatingB.FreezingC.MeltingD.Condensing
In which logic structure, an action, or event, leads to the next ordered action in a predetermined order ?Select one:a.Selectionb.Sequencec.Iterationd.Loop
A solid cuboid is formed by merging 5150 cubes with side length 1. Find the maximum value of the totalsurface area of the cuboid.
One of the zeros of a third order Linear Phase filter lies at z = -0.5. Findtransfer function and Impulse Response of the filter
The value of y is directly proportional to the value of x. When x = 1024, y = 128.What is the value of y when x = 64? A. 32 B. 8 C. 16 D. 256
Which of the following are NOT possible candidates for dark matter?Group of answer choicesBlack holesBrown DwarfsMACHO'sRed Giant Stars
Which of the following is NOT a criteria pollutant?Question 6Select one:a.carbon monoxideb.volatile organic compoundsc.sulfur dioxided.ozone
[L] contain weak alkalis such as magnesium hydroxide and aluminium hydroxide to neutralize the excess acid in the stomach in order to relief stomachache.
If you write down all the numbers from 1 to 100, then how many times do you write 3 ?Options11202118
The Townshend Acts       A:  What did the act do?        B:  How did the colonists respond?
A quantity p varies partly t and partly as the square of t, when t=20, p=45 and when t=24, p=60. (i) Express p in terms of t.(ii) Find p when t=32
(2) With examples differentiate between emerging and re-emerging infectious diseases (10 marks)
For a pilot sitting in the left seat of a Cessna 152, what instrument would be most at risk of parallax error?
What does the 'awk' command do?*1 pointa) Calculate mathematical expressionsb) Search and replace text in filesc) Count lines in a filed) Display file content
X can do a piece of work in 8 days, Y can do it in 10 days and Z can do it in 20 days. In how many days can X, Y and Z together complete the work?
Which SOC tool allows an organization to define incident analysis and response procedures in a digital workflow format.1 pointDLPSOAREDRSIEM
The coordinate (4,3) becomes (2.733,4.187) when the coordinate axes arerotated at θ counterclockwise. What is θ?
The Marks of 10 students in an English test are given below: 10, 21, 22, 35, 37, 13, 16, 18, 24, 34  What is the population standard deviation of the data?
Fe2O3 + 3 CO --> 2 Fe  + 3 CO2How many mole of Fe are produced from 1.5 mol of CO?Group of answer choices3.0 mol4.5 mol1.0 mol2.0 mol
Injury to which nerve of the leg can most likely lead to atrophy of the lateral calf?
A boy was asked to multiply a number by 25 but by mistake he multiplied by 45 and the answer was 200 more than the correct answer. What was the number?78910
How are dictionaries different from list?Ans: List are ordered collection and Dictionary are unordered collection of elements.
Which of the following bank assets is the most liquid?A) consumer loansB) reservesC) state and local government securitiesD) U.S. government securities
Input FormatThe first line of input consist of a Binary numberOutput FormatPrint the decimal equivalent for the given Binary number
A ball bearing is projected upwards from the ground with a velocity of 15 ms^-1. Calculate the time taken by the ball to return to the ground
Find the compound interest on Rs. 9375 at 8% per annum for 2 yr?OptionsRs.1560Rs.1590Rs.1548Rs.1512
Which of the following are distinguishing traits of character?Multiple select question.Self interestEmpathySense of purposeConsistencyOpenness
To protect tooth decay we are advised to brush our teeth regularly.The nature of the tooth paste commonly used is(a) acidic(b) neutral(c) basic(d) corrosive
Which among these switches is an example of SPDTCapacitive Touch switchPsuh buttonTact switchToggle switch
Rank the steps of meiosis II in the correct order in which they occur, beginning with the first step at the top.
What is the basis of two types of tests were being done? Why might two types oftests be required for triplet repeat expansions
what are some language features are used in the black mirror episode metal head to adhere to the dystopic genre
g) What advantages are there to a language-processing system in which the compiler pro duces assembly language rather than machine language?
In which domains HCI has implemented with great importance ?Select one:a.Computer Scienceb.Psychologyc.Sociologyd.All of the mentioned
Determine the best investment option using the maximin decision criteria.Group of answer choicesoffice buildingmallwarehousecondominiumsoffice park
What is the output when following code is executed ?>>> str1 = 'hello'>>> str2 = ','>>> str3 = 'world'>>> str1[-1:]
Which of the following do asymmetric cryptography systems provide? Select all that apply.1 pointAuthenticity ConfidentialityAvailability Non-repudiation
What is the average salary of a Mid-level Software Developer? $9,886 $11,993.90 $8,197.03 $12,300.27 I don't know
Calculate the No. of moles in the following :64 g oxygen molecule (O2)12 g Helium
Describe your understanding of the term ‘airmanship’ in relation to managing human performance.
Can you think of any alternatives to the current consumerist model that could reduce waste and promote sustainability?
What skills or personal qualities would you want to develop or improve if you became a Shamiri fellow? Limit your answer to no more than 5 sentences.*
Given a square matrix, calculate the absolute difference between the sums of its diagonals
Which of these physical quantities are vectors?*1 pointvelocityspeeddistanceforcedisplacementgravity
dating places fossils into a sequence of events without assigning a specific age.
(a) Find the eigenvalues, eigenvectors and eigenspaces forA =1 0 53 6 02 0 10(b) Calculate the determinant and trace of A directly and using eigen-values.
Which of the following activities will create income tax nexus through physical presence
ve balls are drawn from a bag containing6 white and 4 black balls. What; is theprobability that 3 are white and 2 black ?
What is the primary focus of the Rimmer Model in the context of transport development?
Which of the following connector types would be used to connect to the demarcation point and provide network access
Historical Cost (Vehicle) - Accumulated Depreciation = Select ALL correct optionsResale Value1Residual Value2Book Value3Carrying Amount
Which of the following is a tool in the Formula Menu that can use when Auditing a worksheet? Remove Arrows Remove Precedents Remove Dependents Formula Auditor
Plot points with top and bottom 5%  mean kriging variance (use different point shapes for top and bottom points).
A sum of money is put on CI for 2 years at 20%. It would fetch Rs 482 more if the interest is payable half yearly than if it were payable yearly. Find the sum.
Identify the class of the following IPv4 binary address: 10111110.10101001.10101010.10011001.a.Ab.Dc.Ed.Ce.B
what is the most accurate description of fitness components assessing a multi-stage fitness test?
Which of the following Powershell commands will verify that a software package called “TestPackage” has been successfully installed on your system?
Which of the following is a valid variable name in Python?Points:1I don't knowglobalmy_variable$price2name
is caused by the precipitation of ore minerals from hydrothermal fluids that reached shallow crustal levels.
Decision trees can handle2 pointshigh dimensional dataLow dimensional dataMedium dimensional dataNone of these
Line p passes through the points (–2,7) and (6,3). What is the slope of the image of p after a dilation with a scale factor of 2 centered at (–3,1)?
Find two integers with the given product and sum. Show your complete working. a. product = 45, sum = 14b. product = 6, sum = −5
What immunoglobulin rises quickly during secondary immune response?Group of answer choicesIgGIgAIgMIgE
In American born chinese What artistic choices did Yang make when describing the dinner party conflict? What effect did these have on you?
Which of the following is true?Wrap/Unwrap is used to encrypt/decrypt data.Wrap/Unwrap is used to encrypt/decrypt Keys.
WHICH OF THE FOLLOWING IS USED AS AN INDICATOR IN THE TITRATION OF A WEAK ACID AND A STRONG BASE?
Outline two ways in which pathways between school and community basedphysical activity could be strengthened
An example of statistical inference is ___.  Group of answer choiceshypothesis testingcalculating the size of a samplea population meandescriptive statistics
Which modeling technique is commonly used for analyzing complex and multi-dimensional data in data warehousing?
A basic Blank 8 Question 2 is used to implicitly express that Assets (A) equals Liabilities (L) plus Owner’s Equity (OE).
Suppose two n × n matrices A and B are similar.(a) (8 pts) Show that A and B have the same eigenvalues
The ratio of mean value over ore half cycle to the rms value of a.c. of complete cycle
Companies conduct market research on:Multiple select question.obsolete productsglobal trendsbusiness trendsecological impact of decisions
The indicator that gives you more information about how acidic or alkaline a solution is
Find all possible Taylor and Laurent series expansions for the function(2z + 3)/((z + 1)(z + 2)) around z = 1 and specify the domain of validity.
: Two numbers are in the ratio 2 : 3 and their LCM is 180. What is the HCF of these numbers?
Which one of the following structures represents n-butyl methanoate?Question 6Answera.CH3CH2CH2COOCH3b.CH3COOCH2CH2CH2CH3c.HOOCCH2CH2CH2CH3d.CH3CH2CH2CH2COOCH3
A pizza shop has available toppings of sausage, peppers, bacon, mushrooms, and pepperoni. How many different ways can a pizza be made with 4 toppings?
Describe the possible lengths of the third side of the triangle given that the lengths of the other two sides are 5 inches and 12 inches.
The area of a rectangle is 56.96 m2.If the length is 16 m, what is its perimeter?
Explain how the monster feels about his creator, Victor Frankenstein. Why might the monster be so profoundly moved by Milton’s words? Explain.
The minimum energy required by a hydrogen atom in ground state to emit radiation in Balmer series is nearly:
4. Draw an obtuse-angled ∆LMN. Draw its altitudes and denote the orthocenter by ‘O’.
What are the likely reasons behind a change in contract administration, such as an increased project manager's presence or an additional supervisor's presence?
The path of a moving charged particle in a magnetic field is ……… * 1 point linear circular spiral downward
Through which satellite system does Radio Networking (RN) deliver reliable high-fidelity program channels for both National and Regional Networking?
1mile = 1610mCalculate the acceleration of a school minibus which can accelerate from rest to 40mph in 18s.
What is the correct way to declare and initialize a one-dimensional array in C?
3. How was the White Australia policy changed after the Second World War ended in 1945?
What does SPF email authentication actually do?sendSend message. Messages are recorded.Checking who can access fileutq-uyvh-kpe
What is the NPV of a project that costs $100,000 and returns $50,000 annually for 3 years if the opportunity cost of capital is 14%?
why 6 is added in BCD addition when the result is greater then 9?  *Your answer
Drawing on any persuasion theory explain how you would convince digital customers to buy a product you are marketing through a digital platform of your choice
With reference to the source outline two (2) requirements for legislation to be considered effective.(4 marks)
How does Cisco Umbrella differentiate which policy to apply for incoming DNS requests?
It is one of the most beneficial _____  _______ _________ because the water containing fish waste is used to fertilize the agricultural field.
Explain what happens to caesium atoms and to oxygen atoms when caesium reactswith oxygen to produce caesium oxide.You should answer in terms of electrons.
Which amongst the following can be observed when zinc granules are added to dilute hydrochloric acid taken in a test tube?
What attracts the most attention in a print ad or banner ad (per unit of page/screen)?a) Illustrationb) Headlinec) Textd) Logo
a particualr situation beyond the fullempolyment where only price level increses with no change level outuput is known as
The library function used to find the last occurrence of a character in a string is
What social institution in the Philippines do you think we need to focus in determining the social bond? Explain why?
Which solution of CuCl₂ will lead to the fastest reaction with aluminum?*10g CuCl₂ in 100mL5g CuCl₂ in 50mL5g CuCl₂ in 100mL10g CuCl₂ in 50mL
How many of the following elements do not respond to sodium fusion extract? N, P, S, C, O, X
Exchange of gas is the function of the circulatory system.Question 18Answera.Trueb.False
Epsilon Indi is a main sequence star. Show that the mass of Epsilon Indi is 0.64 M
What does the loser have the right to do?counter sue the government for damagesIgnore the decisionAppeal to the next level of courts
Which of the following are elements of social structure?Multiple select question.statusessocial networkssocial rolessocial conflictssocial institutionsgroups
What is the greatest concern during exercise with a person who has diabetes mellitus? Ketosis. Hyperglycemia Hypoglycemia Dehydration.
Would you call the person at the coffee shop a salesperson or an order taker? Why?
On the basis of electronic configuration of 95 X, the group number andperiod of the element ‘X’ is :
The director is responsible for:Group of answer choiceshiring the crew.rewriting the script.deciding where the camera goes.realizing the look of the film.
In the production of polymers, what is the purpose of the polymerization process?
Select all of the following that function in plants living in hot, dry climates.Group of answer choicesCAM photosynthesisC4 photosynthesisC3 photosynthesis
2. What will be the output of the following Python code?>>>str="hello">>>str[:2]>>>
Which of the following AWS services support VPC Endpoint Gateway for a private connection from a VPC? (Select two)
Q7.Which WordPress hook is typically used to register custom menus?initwp_enqueue_scriptsafter_setup_themewp_head
Should Netflix continue to operate in the Indian market alone, or work with a local player in India to accelerate its growth in the Indian market?
If all Zips are Zaps and some Zaps are Zops, then...All Zips are ZopsAll Zops are ZipsSome Zops are ZapsSome Zips are Zops
Print the count of number of elements in union and intersection separated by space.Constraints1 <= N, M <= 100
Select one type of Clinical Decision Support used in EHRs, provide an example and a brief description of the example you list.
What does it mean to sayan:i. agent lacks autonomyII. environment is uncertainiii. agent has an unobservable environment
Ramesh’s salary was reduced by 10% and then the reduced salary was increased by 10%.What was his ultimate loss?0%10%1%5%
Which of the following is a form of functional testing?a) Security level testingb) Boundary value analysisc) Performance testingd) Usability testing
Accommodation enables the person to:Focus on distant objectsFocus on near objectsFocus light to the retinaFocus the light to the lens
What smallest number should be subtracted from 8485 so that it is completely divisible by 75?Select one:a. 10b. 15c. 20d. 45e. 65
What is the probability that a card drawn at random from a pack of 52 cards is either a king or a spade?Question 1Answera.17/52b.13/52c.4/13d.3/13
If for a square matrix A, A2 3A + I = O and A 1 = xA + yI, then thevalue of x + y is :
efficiency is producing output at the lowest possible average total cost of production.
If the tension in a length of string is doubled, the wavelength of standing waves in the string changes by what factor?Select one:a.1/√2b.1/2c.1d.2e.√2
consider the healthcare economics of two adjacent counties in the Kansas City metropolitan area.
Organizations that provide the enforcement mechanism.Select one:a.AICPA and FASBb.SEC and AICPAc.GAAP and FASBd.FASB and SEC
What is the general representation of PDB id?Where X is any integer, and B, C, and D are any alphabet
What is the effect of setting the security mode to WEP on a small wireless router?
Which of the following are classes of JDBC API?a)Types classb)All of the mentionedc)Clob classd)Blob classe)DriverManager class
True or False. Luke most likely did not write Hebrews because we see no medical terminology in the book.
In a western blot experiment, the actin protein is probed with a mouse monoclonal primary antibody. The secondary HRP conjugated protein should be
Multiplier effects describe how small changes in financial resources can be amplified through modern economic processes, sometimes to great effect.
In a sequential game, a firm will always want to be the leader to take advantage of the first-mover advantage.Group of answer choices
The angles of a quadrilateral are 4x, 7x, 15x and 10x. Find the smallest and the largest angles of the quadrilateral
Where do plants get their energy from?They perform cellular respiration and use the glucose they createThe sunChemosynthesis
describe the key factors that influence speed, strength and fatigue associated with muscle contraction.
A skydiver is falling at a constant 6.40 m/s. If the force due to air resistance on her is 580 N,then determine her mass.
Which of the following nitrogen containing compound does not give Lassaigne's test?JEE Main 2024 (04 Apr Shift 1)AUreaBPhenyl hydrazineCGlyceneDHydrazine
What is the probability of the random arrangement of letters in the word "UNIVERSITY" such that the two I's should be together? A. 1/5 B. 3/5 C. 2/7 D. 1/7
What will be the Least Common Multiple of the numbers divisible by 3 between 26 and 32?
Simulation Tools used to ___________ how real‐time variability can impact supply chain performance and riska.judgeb.evaluatec.decided.analysis
How many attributes of successful believers are described at the beginning of Surah al-Mu'minun?
What least number must be subtracted from 1672 to obtain a number which is completely divisible by 17?Options :A. 5B. 7C. 3D. 6
There are 30 cars crossing the roadway every hour. What is the probability that only one car will cross in next 5 minutes?A.0.2052B.0.9179
Two concentric circles of radii a and b (a > b) are given. Find the length of the chord of the larger circle which touches the smaller circle.
Which of the following statements about alternative treatments (two ways of accounting) for adjusting entries is correct?
The cube of a number A is proportional to the fourth power of another number B. If B = 8, then A = 8. If B = 3, what is the value of A?3
The Emancipation Proclamation of 1863 completely freed the black people from slavery. Do you agree?
Select the correct answerThe values of the attribute should be present in ________.
Find all sixth roots of the complex number 32√2(1 + i), and plot and label them on thecomplex plane by hand1
All possible words, with our without meaning can be formed using all the letters of the word SPUTNIK. Find the probability that all vowel never occur together.
"A comparative analysis of rental variation in residential and commercial properties in eyenkole community, ejigbo", what are the variables to this topic
A car starts from rest and accelerates uniformly over a time of 5.21 seconds for a distance of 110 m. Determine the acceleration of the car.
Prove from first principles that the sequence (an) is convergent, wherean = (−1)n + n2n + 1for all n.
Find the midpoint of the line segment with the endpoints A and B. ​A(8​,2​); ​B(4​,6​)
In addition to secreting digestive enzymes, the pancreas is an endocrine organ, because it secretes such as insulin.
Which of the following erosion is not caused by wind?Options :SuspensionSaltationSurface creepSplash erosion
elect the correct answer.Which graph is the graph of the function 𝑟⁡(𝑥)=𝑥2+6⁢𝑥+82⁢𝑥+8 ?
Which of the following is the most efficient means of product quality inspection?a.Acceptance samplingb.100% inspectionc.Variable sampling
The measure of three angles of a triangle are in the ratio 5 : 3 : 1. Find the measures of these angles.
Which of the following is related to sustainable development?  A. Resource Conservation  B. Misuse of resource  C. Climate Change  D. Acid Rain
You have 1,312 grams of a radioactive kind of lanthanum. If its half-life is 93 minutes, how much will be left after 279 minutes?
Why do pots have wooden handles?Question 19AnswerA.To increase heat retentionB.To enhancing durabilityC.To enhance appearanceD.To minimize heat conduction
A man running uniformly at  8 𝑚/𝑠  is  16 𝑚  behind a bus when it starts accelerating at  2 𝑚𝑠−2. Time taken by him to board the bus is
Differentiate between developed and underdeveloped countries on the basis ofimpact of the shocks and stimulants.
Write a query to display the entire contents of the 'electricity_connection_type'. Display the records in ascending order based on their connection name.
hy the chromosomenumber has reduced to half in daughter cells?Rationalised 2023-24
Draw a mechanism (with arrow pushing) of the reaction of 1-Bromohexane with Potassium Tert-butoxide forming their elimination product
Research Assists in making increasingly complex decision ona.Goalsb.Strategiesc.Tacticsd.Goals , Strategies and Tactics
The front wheel of a steam roller is 2 m high and 8 m across. What is the entire surface area of the steam roller’s front wheel?a bc d
In triangle ABC, the length of side AB is 8. If the measure of ∠A and the measure of ∠B are equal, which of the following is NOT a possible length of side BC?
When is it appropriate to get involved in a war that is not happening in your country?
A stone is released from the top of a tower of height 19.6 m. Calculate its final velocity just before touching the ground.
The number of ways 4 friends can occupy 9 empty chairs in a stage where chairs arranged linearly is _________.Choices:- 3414 3249 3024 3104
Find the exact value of arcsinsin4π3.Write your answer in radians in terms of π.
The concept __________ refers to the recognized violation of cultural norms.A.devianceB.theftC.social controlD.crime
The presence of hormones produced by the after implantation prevent menstruation.
How is corporate governance integral in preventing ethical breaches like the Wells Fargo scandal?
Find the zeros of the polynomial2 1 26x x  , and verify the relation between thecoefficients and zeros of the polynomial.
Write a program to convert the given graph from matrix representation to linked list representation
What will you see on the terminal?int main(void){ int *ptr; *ptr = 98; printf("%d\n", *ptr); return (0);}
List the two variables that ultimately determine the method of cooking, when a food item is fully cooked to its appropriate internal temperature.
A thin and flat piece of plastic containing various cut-out shapes. It is designed to increase the speed and accuracy of the drafter
How many elements of actinoids including actinium are having no any electron in 5f subshell in their ground state?
is an optimization algorithm that combines the benefits of gradient descent and momentum to accelerate convergence
he famous poet Amir Khusrau was contemporary of all except the following: Alauddin Khilji Ghiyasuddin Balban Iltutmish Jalaluddin Khilji
The smallest number by which 588 must be divided so that the product is a perfect square?
Create a plan to implement any of the guidelinesthat you do not currently have in place to keepyour data confidential.
Price competition starts to occur in ___________ phase of the product life cycleSelect one:a.Introductionb.Growthc.Saturationd.Decline
How do you think the first explorers in Africa might have influenced later European explorers?
A shopkeeper bought a chair for ` 375 and sold it for ` 400. Find the gain Percentage
What is the Government Official's title, and his or her roles and responsibilities?
Why is it important to include evidence of internal audits in a vendor assessment process?
do you have nay concept related to past of odisha? i only need spatial concept that is placing of spaces.
Jeff has been asked to replace a monitor on a workstation. Which of the following device interfaces could he use to connect the new monitor?answerSSIDUSBUPSDVI
The voltage of an ac supply varies with time (t) asV = 120 sin 100 t cos 100 t. The maximumvoltage and frequency are :
How do media creators use technical codes, such as camera angles, lighting, and editing, to convey meaning in different media types?
Discuss six strategic positioning choices which the strategic managers can make inorder to maintain a competitive advantage in their organization.
If the total surface area of a cube is 2646 cm2, then find the length of each side of the cube.
A forklift raises a box 1.0 m doing 6.0 kJ of work on it. What is the mass of the box?
The inducement of red blood cell adhesion to blood vessels in the brain is called , a condition that is induced by the Plasmodium pathogen.
What property of Row/Column decides where to put the extra space?*1 pointmainAxisAlignmentflexcrossAxisAlignmentchildren
Compute the theoretical shear stress in order to have a slippage of two atomicplanes relative to each other
Which of the following is an example of an AWS instance type?Group of answer choicest2.microEC2S3RDS
Enhancing communication channels and providing language training programs defined as
Which of the following is NOT a characteristic of a theory?a. Journalists monitor powerb. Falsifiabilityc. Logical consistencyd. Testability
Which one of the following can be used as an acid-base indicator by a visually impaired student ? LitmusTurmericVanilla essencePetunia leaves
For todays' activity.ESSAY: Write down your ideas about modeling and simulation and what you have learn on this subject.
Which of the following molecules contain polar covalent bonds: CO, N2, NH3, NH4+, and HCl?
Which compound is a suitable starting material to prepare dichlorocarbene (in the box)?Group of answer choices
The word most opposite in meaning to “rescind” is: command disclaim aimless reproduce
The number 0.005900, in standard scientific form can be expressed as ______a) 5.9×103b) 59×104c) 5.9×102d) 5.9×104
The base of a right triangle is 8 cm and hypotenuse is 10 cm. Its area will be :a.40 cm2b.48 cm2c.24 cm2d.80 cm2
What will be the output of the following Python code?1.  def foo():2.     try:3.       print(1)4.    finally:5.        print(2)6.   7.  foo()
Which one among the followings is responsible for making the acidic food coming from stomach alkaline?
Keynes asserts that the inflationary gap is brought on by .a.a lack of demandb.a surplus of supplyc.a surplus of demandd.a lack of supply
Suppose that f(5) = 1, f '(5) = 8, g(5) = −4, and g'(5) = 2. Find the following values.(a)    (fg)'(5) (b)    (f/g)'(5) (c)    (g/f)'(5)
If you increase the depth at which an object is submerged in a fluid, what happens to the pressure at that depth?
The partial pressure of CO2 is in the atmospheric air compared to the partial pressure in blood.
The length of the bridge, which a train 130 metres long and travelling at 45 km/hr can cross in 30 seconds, is:
The PSISA, or Private Security and Investigative Services Act, was established in
Which kingdoms have photosynthetic organisms? plants and animalsfungi and protistsprotists and plants fungi and plants
According to this Scientist the earth is composed of a large landmasses was called PANGAEA.
Name the transfer that occurs when rainwater penetrates the soil, dissolving and removing minerals such as nitrates and phosphates.
A pentagonal prism has a length of 8cm.The area of its pentagonal faces is 43cm2 and the sides of the pentagons are each 5cm.Find its surface area.
1.0 dm3 of an ideal gas at 100 kPa and 25 °C is heated to 50 °C at constant pressure. What is the new volume in dm3?
Which two statements are limitations of the clientless SSL VPN solution? (Choose two.)
What is a disadvantage to a business of using scarce resources in their products?
Identify which two of the following are non-contact forces.Applied forceGravityAir resistanceMagnetism